C22H21N5O5S — CID 2977799
N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 2977799) has the molecular formula C22H21N5O5S and a molecular weight of 467.51 g/mol. Its IUPAC name is N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 2977799 |
| Molecular Formula | C22H21N5O5S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | CN1C(=O)c2ccc(NC(=S)NC(=O)c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)cc2C1=O |
| InChI | InChI=1S/C22H21N5O5S/c1-25-20(29)15-7-6-14(12-16(15)21(25)30)23-22(33)24-19(28)13-5-8-17(18(11-13)27(31)32)26-9-3-2-4-10-26/h5-8,11-12H,2-4,9-10H2,1H3,(H2,23,24,28,33) |
| InChIKey | KUCBIVOPLXRUJS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|