C27H27N5O4S — CID 17314715
N-[(4-benzamido-3-methylphenyl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 17314715) has the molecular formula C27H27N5O4S and a molecular weight of 517.61 g/mol. Its IUPAC name is N-[(4-benzamido-3-methylphenyl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[(4-benzamido-3-methylphenyl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17314715 |
| Molecular Formula | C27H27N5O4S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-[(4-benzamido-3-methylphenyl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)ccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H27N5O4S/c1-18-16-21(11-12-22(18)29-25(33)19-8-4-2-5-9-19)28-27(37)30-26(34)20-10-13-23(24(17-20)32(35)36)31-14-6-3-7-15-31/h2,4-5,8-13,16-17H,3,6-7,14-15H2,1H3,(H,29,33)(H2,28,30,34,37) |
| InChIKey | HLWFIWFIHXIAII-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|