C15H10Cl2N2OS — CID 91683689
N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-2-chloroacetamide (PubChem CID 91683689) has the molecular formula C15H10Cl2N2OS and a molecular weight of 337.23 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-2-chloroacetamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 91683689 |
| Molecular Formula | C15H10Cl2N2OS |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-2-chloroacetamide |
| SMILES | O=C(CCl)Nc1cc(-c2nc3ccccc3s2)ccc1Cl |
| InChI | InChI=1S/C15H10Cl2N2OS/c16-8-14(20)18-12-7-9(5-6-10(12)17)15-19-11-3-1-2-4-13(11)21-15/h1-7H,8H2,(H,18,20) |
| InChIKey | GSASRLWHKFBHIO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|