C29H22Cl2N2O3 — CID 5032761
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]prop-2-enamide (PubChem CID 5032761) has the molecular formula C29H22Cl2N2O3 and a molecular weight of 517.41 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5032761 |
| Molecular Formula | C29H22Cl2N2O3 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]prop-2-enamide |
| SMILES | CC(C)c1ccc2oc(-c3cccc(NC(=O)C=Cc4ccc(-c5cccc(Cl)c5Cl)o4)c3)nc2c1 |
| InChI | InChI=1S/C29H22Cl2N2O3/c1-17(2)18-9-12-26-24(16-18)33-29(36-26)19-5-3-6-20(15-19)32-27(34)14-11-21-10-13-25(35-21)22-7-4-8-23(30)28(22)31/h3-17H,1-2H3,(H,32,34) |
| InChIKey | ZFENYQXAAPIHMV-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|