C20H17N3O2S — CID 60602799
(E)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 60602799) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is (E)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 60602799 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (E)-3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | CC(C)n1cc(C(=O)/C=C/c2ccc(-c3nc4ccccc4s3)o2)cn1 |
| InChI | InChI=1S/C20H17N3O2S/c1-13(2)23-12-14(11-21-23)17(24)9-7-15-8-10-18(25-15)20-22-16-5-3-4-6-19(16)26-20/h3-13H,1-2H3/b9-7+ |
| InChIKey | QJGFNWMJDYIBAR-VQHVLOKHSA-N |
| XLogP | 5.23 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|