C29H23N5O — CID 135602659
(E)-2-(4-oxo-3H-quinazolin-2-yl)-3-[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]prop-2-enenitrile (PubChem CID 135602659) has the molecular formula C29H23N5O and a molecular weight of 457.54 g/mol. Its IUPAC name is (E)-2-(4-oxo-3H-quinazolin-2-yl)-3-[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(4-oxo-3H-quinazolin-2-yl)-3-[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 135602659 |
| Molecular Formula | C29H23N5O |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (E)-2-(4-oxo-3H-quinazolin-2-yl)-3-[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]prop-2-enenitrile |
| SMILES | Cc1cc(C)c(-c2nn(-c3ccccc3)cc2/C=C(\C#N)c2nc3ccccc3c(=O)[nH]2)c(C)c1 |
| InChI | InChI=1S/C29H23N5O/c1-18-13-19(2)26(20(3)14-18)27-22(17-34(33-27)23-9-5-4-6-10-23)15-21(16-30)28-31-25-12-8-7-11-24(25)29(35)32-28/h4-15,17H,1-3H3,(H,31,32,35)/b21-15+ |
| InChIKey | XRTLOCZUBPMQMA-RCCKNPSSSA-N |
| XLogP | 5.77 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|