C15H10ClNO2 — CID 912015
2-(4-chlorophenyl)-3-(3,4-dihydroxyphenyl)prop-2-enenitrile (PubChem CID 912015) has the molecular formula C15H10ClNO2 and a molecular weight of 271.70 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(3,4-dihydroxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(4-chlorophenyl)-3-(3,4-dihydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 912015 |
| Molecular Formula | C15H10ClNO2 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(3,4-dihydroxyphenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(O)c(O)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10ClNO2/c16-13-4-2-11(3-5-13)12(9-17)7-10-1-6-14(18)15(19)8-10/h1-8,18-19H |
| InChIKey | AVEAJLIUFNKMPU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|