C15H11NO2 — CID 22080485
(Z)-3-(3,4-dihydroxyphenyl)-2-phenylprop-2-enenitrile (PubChem CID 22080485) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is (Z)-3-(3,4-dihydroxyphenyl)-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-(3,4-dihydroxyphenyl)-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 22080485 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (Z)-3-(3,4-dihydroxyphenyl)-2-phenylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C15H11NO2/c16-10-13(12-4-2-1-3-5-12)8-11-6-7-14(17)15(18)9-11/h1-9,17-18H/b13-8+ |
| InChIKey | UUDLANULWQCWAS-MDWZMJQESA-N |
| XLogP | 3.16 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|