C20H15BrN2O4 — CID 2964060
3-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile (PubChem CID 2964060) has the molecular formula C20H15BrN2O4 and a molecular weight of 427.25 g/mol. Its IUPAC name is 3-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile.
| Compound Name | 3-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2964060 |
| Molecular Formula | C20H15BrN2O4 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 3-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile |
| SMILES | C#CCOc1c(Br)cc(C=C(C#N)c2cccc([N+](=O)[O-])c2)cc1OCC |
| InChI | InChI=1S/C20H15BrN2O4/c1-3-8-27-20-18(21)10-14(11-19(20)26-4-2)9-16(13-22)15-6-5-7-17(12-15)23(24)25/h1,5-7,9-12H,4,8H2,2H3 |
| InChIKey | WXWAALOATCLYHK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|