C12H11NO5 — CID 58747243
(Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-isocyanoprop-2-enoic acid (PubChem CID 58747243) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is (Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-isocyanoprop-2-enoic acid.
| Compound Name | (Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 58747243 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1cc(OC)c(O)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C12H11NO5/c1-13-8(12(15)16)4-7-5-9(17-2)11(14)10(6-7)18-3/h4-6,14H,2-3H3,(H,15,16)/b8-4- |
| InChIKey | ZINDDPLTHFORTM-YWEYNIOJSA-N |
| XLogP | 1.75 |
| TPSA | 80.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|