C23H14N2O3S — CID 2352846
(E)-3-(1,3-benzodioxol-5-yl)-2-(phenothiazine-10-carbonyl)prop-2-enenitrile (PubChem CID 2352846) has the molecular formula C23H14N2O3S and a molecular weight of 398.44 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-2-(phenothiazine-10-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-2-(phenothiazine-10-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2352846 |
| Molecular Formula | C23H14N2O3S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-2-(phenothiazine-10-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc2c(c1)OCO2)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C23H14N2O3S/c24-13-16(11-15-9-10-19-20(12-15)28-14-27-19)23(26)25-17-5-1-3-7-21(17)29-22-8-4-2-6-18(22)25/h1-12H,14H2/b16-11+ |
| InChIKey | SONKWJVUQSRJFR-LFIBNONCSA-N |
| XLogP | 5.15 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|