C17H14N4O3 — CID 2426251
(E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N,N-bis(2-cyanoethyl)prop-2-enamide (PubChem CID 2426251) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N,N-bis(2-cyanoethyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N,N-bis(2-cyanoethyl)prop-2-enamide |
|---|---|
| PubChem CID | 2426251 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N,N-bis(2-cyanoethyl)prop-2-enamide |
| SMILES | N#CCCN(CCC#N)C(=O)/C(C#N)=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14N4O3/c18-5-1-7-21(8-2-6-19)17(22)14(11-20)9-13-3-4-15-16(10-13)24-12-23-15/h3-4,9-10H,1-2,7-8,12H2/b14-9+ |
| InChIKey | UAKOPXDXBCCBFW-NTEUORMPSA-N |
| XLogP | 1.98 |
| TPSA | 110.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|