C24H26N2O6 — CID 102304584
tert-butyl N-[2-(3,4,5-trimethoxyphenyl)quinoline-4-carbonyl]carbamate (PubChem CID 102304584) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is tert-butyl N-[2-(3,4,5-trimethoxyphenyl)quinoline-4-carbonyl]carbamate.
| Compound Name | tert-butyl N-[2-(3,4,5-trimethoxyphenyl)quinoline-4-carbonyl]carbamate |
|---|---|
| PubChem CID | 102304584 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | tert-butyl N-[2-(3,4,5-trimethoxyphenyl)quinoline-4-carbonyl]carbamate |
| SMILES | COc1cc(-c2cc(C(=O)NC(=O)OC(C)(C)C)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C24H26N2O6/c1-24(2,3)32-23(28)26-22(27)16-13-18(25-17-10-8-7-9-15(16)17)14-11-19(29-4)21(31-6)20(12-14)30-5/h7-13H,1-6H3,(H,26,27,28) |
| InChIKey | YULQFKQTVSXDIQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |