C26H31N3O5 — CID 54697692
2-(diethylamino)ethyl 4-[(4-hydroxy-2-oxo-1-propylquinoline-3-carbonyl)amino]benzoate (PubChem CID 54697692) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(4-hydroxy-2-oxo-1-propylquinoline-3-carbonyl)amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[(4-hydroxy-2-oxo-1-propylquinoline-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 54697692 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(4-hydroxy-2-oxo-1-propylquinoline-3-carbonyl)amino]benzoate |
| SMILES | CCCn1c(=O)c(C(=O)Nc2ccc(C(=O)OCCN(CC)CC)cc2)c(O)c2ccccc21 |
| InChI | InChI=1S/C26H31N3O5/c1-4-15-29-21-10-8-7-9-20(21)23(30)22(25(29)32)24(31)27-19-13-11-18(12-14-19)26(33)34-17-16-28(5-2)6-3/h7-14,30H,4-6,15-17H2,1-3H3,(H,27,31) |
| InChIKey | FWAMXXMOIZQQJA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |