C21H21BrN2O3 — CID 110501339
5-bromo-2-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoic acid (PubChem CID 110501339) has the molecular formula C21H21BrN2O3 and a molecular weight of 429.31 g/mol. Its IUPAC name is 5-bromo-2-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoic acid.
| Compound Name | 5-bromo-2-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 110501339 |
| Molecular Formula | C21H21BrN2O3 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 5-bromo-2-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoic acid |
| SMILES | CCCCn1c(C(=O)Nc2ccc(Br)cc2C(=O)O)c(C)c2ccccc21 |
| InChI | InChI=1S/C21H21BrN2O3/c1-3-4-11-24-18-8-6-5-7-15(18)13(2)19(24)20(25)23-17-10-9-14(22)12-16(17)21(26)27/h5-10,12H,3-4,11H2,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | BAKIGGVIKZYHEQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|