C18H24N2O3 — CID 110497523
2-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]butanoic acid (PubChem CID 110497523) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]butanoic acid.
| Compound Name | 2-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 110497523 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]butanoic acid |
| SMILES | CCc1ccc2c(c1)c(C)c(C(=O)NC(CC)C(=O)O)n2CC |
| InChI | InChI=1S/C18H24N2O3/c1-5-12-8-9-15-13(10-12)11(4)16(20(15)7-3)17(21)19-14(6-2)18(22)23/h8-10,14H,5-7H2,1-4H3,(H,19,21)(H,22,23) |
| InChIKey | LTJZBKDBPUFQQE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|