C24H29ClN2O3 — CID 110497706
5-chloro-N-[2-(3,4-diethoxyphenyl)ethyl]-1-ethyl-3-methylindole-2-carboxamide (PubChem CID 110497706) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is 5-chloro-N-[2-(3,4-diethoxyphenyl)ethyl]-1-ethyl-3-methylindole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(3,4-diethoxyphenyl)ethyl]-1-ethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110497706 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 5-chloro-N-[2-(3,4-diethoxyphenyl)ethyl]-1-ethyl-3-methylindole-2-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)c2c(C)c3cc(Cl)ccc3n2CC)cc1OCC |
| InChI | InChI=1S/C24H29ClN2O3/c1-5-27-20-10-9-18(25)15-19(20)16(4)23(27)24(28)26-13-12-17-8-11-21(29-6-2)22(14-17)30-7-3/h8-11,14-15H,5-7,12-13H2,1-4H3,(H,26,28) |
| InChIKey | DDOLVQAWYSPDHQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|