C22H23F3N2O — CID 110497558
1,5-diethyl-3-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide (PubChem CID 110497558) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is 1,5-diethyl-3-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide.
| Compound Name | 1,5-diethyl-3-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 110497558 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1,5-diethyl-3-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide |
| SMILES | CCc1ccc2c(c1)c(C)c(C(=O)NCc1cccc(C(F)(F)F)c1)n2CC |
| InChI | InChI=1S/C22H23F3N2O/c1-4-15-9-10-19-18(12-15)14(3)20(27(19)5-2)21(28)26-13-16-7-6-8-17(11-16)22(23,24)25/h6-12H,4-5,13H2,1-3H3,(H,26,28) |
| InChIKey | TVGQKCINBRDEER-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|