C16H21ClN2O3 — CID 110498960
5-chloro-1-ethyl-N,N-bis(2-hydroxyethyl)-3-methylindole-2-carboxamide (PubChem CID 110498960) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is 5-chloro-1-ethyl-N,N-bis(2-hydroxyethyl)-3-methylindole-2-carboxamide.
| Compound Name | 5-chloro-1-ethyl-N,N-bis(2-hydroxyethyl)-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110498960 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 5-chloro-1-ethyl-N,N-bis(2-hydroxyethyl)-3-methylindole-2-carboxamide |
| SMILES | CCn1c(C(=O)N(CCO)CCO)c(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H21ClN2O3/c1-3-19-14-5-4-12(17)10-13(14)11(2)15(19)16(22)18(6-8-20)7-9-21/h4-5,10,20-21H,3,6-9H2,1-2H3 |
| InChIKey | IRZZJDARRXZIKL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|