C15H13F2NOS — CID 46492102
(E)-3-(2,6-difluorophenyl)-N-(2-thiophen-2-ylethyl)prop-2-enamide (PubChem CID 46492102) has the molecular formula C15H13F2NOS and a molecular weight of 293.34 g/mol. Its IUPAC name is (E)-3-(2,6-difluorophenyl)-N-(2-thiophen-2-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(2,6-difluorophenyl)-N-(2-thiophen-2-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 46492102 |
| Molecular Formula | C15H13F2NOS |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | (E)-3-(2,6-difluorophenyl)-N-(2-thiophen-2-ylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(F)cccc1F)NCCc1cccs1 |
| InChI | InChI=1S/C15H13F2NOS/c16-13-4-1-5-14(17)12(13)6-7-15(19)18-9-8-11-3-2-10-20-11/h1-7,10H,8-9H2,(H,18,19)/b7-6+ |
| InChIKey | YXRSPSPLDHFGCX-VOTSOKGWSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|