C19H18F4N2O5 — CID 163327851
2-fluoro-N-[2-[[2-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide;oxalic acid (PubChem CID 163327851) has the molecular formula C19H18F4N2O5 and a molecular weight of 430.35 g/mol. Its IUPAC name is 2-fluoro-N-[2-[[2-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide;oxalic acid.
| Compound Name | 2-fluoro-N-[2-[[2-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide;oxalic acid |
|---|---|
| PubChem CID | 163327851 |
| Molecular Formula | C19H18F4N2O5 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2-fluoro-N-[2-[[2-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide;oxalic acid |
| SMILES | O=C(NCCNCc1ccccc1C(F)(F)F)c1ccccc1F.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H16F4N2O.C2H2O4/c18-15-8-4-2-6-13(15)16(24)23-10-9-22-11-12-5-1-3-7-14(12)17(19,20)21;3-1(4)2(5)6/h1-8,22H,9-11H2,(H,23,24);(H,3,4)(H,5,6) |
| InChIKey | USMRYJKKGXVZON-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|