C23H20ClN3O3S — CID 30561057
2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 30561057) has the molecular formula C23H20ClN3O3S and a molecular weight of 453.95 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 30561057 |
| Molecular Formula | C23H20ClN3O3S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cc2ccc(Cl)cc2)c2ccccc21)NCc1ccccn1 |
| InChI | InChI=1S/C23H20ClN3O3S/c24-18-10-8-17(9-11-18)16-31(29,30)22-14-27(21-7-2-1-6-20(21)22)15-23(28)26-13-19-5-3-4-12-25-19/h1-12,14H,13,15-16H2,(H,26,28) |
| InChIKey | IBUBCHYLBWHHND-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |