C25H31N3O4S — CID 30559058
2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 30559058) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 30559058 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | Cc1ccccc1CS(=O)(=O)c1cn(CC(=O)NCCCN2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C25H31N3O4S/c1-20-7-2-3-8-21(20)19-33(30,31)24-17-28(23-10-5-4-9-22(23)24)18-25(29)26-11-6-12-27-13-15-32-16-14-27/h2-5,7-10,17H,6,11-16,18-19H2,1H3,(H,26,29) |
| InChIKey | MJKODNCIQRZBHV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|