C27H28N2O4S — CID 30559531
N-[2-(2-methoxyphenyl)ethyl]-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]acetamide (PubChem CID 30559531) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)ethyl]-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]acetamide.
| Compound Name | N-[2-(2-methoxyphenyl)ethyl]-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 30559531 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-[2-(2-methoxyphenyl)ethyl]-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]acetamide |
| SMILES | COc1ccccc1CCNC(=O)Cn1cc(S(=O)(=O)Cc2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C27H28N2O4S/c1-20-11-13-21(14-12-20)19-34(31,32)26-17-29(24-9-5-4-8-23(24)26)18-27(30)28-16-15-22-7-3-6-10-25(22)33-2/h3-14,17H,15-16,18-19H2,1-2H3,(H,28,30) |
| InChIKey | GAWDUBFTSLHGNK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |