C22H17ClFNO2S — CID 43952954
1-[(4-chlorophenyl)methyl]-3-[(3-fluorophenyl)methylsulfonyl]indole (PubChem CID 43952954) has the molecular formula C22H17ClFNO2S and a molecular weight of 413.90 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[(3-fluorophenyl)methylsulfonyl]indole.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[(3-fluorophenyl)methylsulfonyl]indole |
|---|---|
| PubChem CID | 43952954 |
| Molecular Formula | C22H17ClFNO2S |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[(3-fluorophenyl)methylsulfonyl]indole |
| SMILES | O=S(=O)(Cc1cccc(F)c1)c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C22H17ClFNO2S/c23-18-10-8-16(9-11-18)13-25-14-22(20-6-1-2-7-21(20)25)28(26,27)15-17-4-3-5-19(24)12-17/h1-12,14H,13,15H2 |
| InChIKey | HOFCPLQOPRITCG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |