C29H31N5O3 — CID 5292420
2-[3-[(E)-2-cyano-3-oxo-3-(4-phenylpiperazin-1-yl)prop-1-enyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 5292420) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyano-3-oxo-3-(4-phenylpiperazin-1-yl)prop-1-enyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[(E)-2-cyano-3-oxo-3-(4-phenylpiperazin-1-yl)prop-1-enyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 5292420 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 2-[3-[(E)-2-cyano-3-oxo-3-(4-phenylpiperazin-1-yl)prop-1-enyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | N#C/C(=C\c1cn(CC(=O)NCC2CCCO2)c2ccccc12)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H31N5O3/c30-18-22(29(36)33-14-12-32(13-15-33)24-7-2-1-3-8-24)17-23-20-34(27-11-5-4-10-26(23)27)21-28(35)31-19-25-9-6-16-37-25/h1-5,7-8,10-11,17,20,25H,6,9,12-16,19,21H2,(H,31,35)/b22-17+ |
| InChIKey | ULFWUXJYABPDGS-OQKWZONESA-N |
| XLogP | 3.19 |
| TPSA | 90.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|