C24H22N4O3 — CID 67274102
2-[3-[(E)-2-cyano-3-oxo-3-(4-phenylpiperazin-1-yl)prop-1-enyl]indol-1-yl]acetic acid (PubChem CID 67274102) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyano-3-oxo-3-(4-phenylpiperazin-1-yl)prop-1-enyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[(E)-2-cyano-3-oxo-3-(4-phenylpiperazin-1-yl)prop-1-enyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67274102 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[3-[(E)-2-cyano-3-oxo-3-(4-phenylpiperazin-1-yl)prop-1-enyl]indol-1-yl]acetic acid |
| SMILES | N#C/C(=C\c1cn(CC(=O)O)c2ccccc12)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H22N4O3/c25-15-18(14-19-16-28(17-23(29)30)22-9-5-4-8-21(19)22)24(31)27-12-10-26(11-13-27)20-6-2-1-3-7-20/h1-9,14,16H,10-13,17H2,(H,29,30)/b18-14+ |
| InChIKey | YFCBYLITQVTKCU-NBVRZTHBSA-N |
| XLogP | 2.98 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|