C22H17N3O3 — CID 67273865
2-[3-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid (PubChem CID 67273865) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-[3-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67273865 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-[3-[2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
| SMILES | N#CC(=Cc1cn(CC(=O)O)c2ccccc12)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C22H17N3O3/c23-12-16(22(28)25-10-9-15-5-1-3-7-19(15)25)11-17-13-24(14-21(26)27)20-8-4-2-6-18(17)20/h1-8,11,13H,9-10,14H2,(H,26,27) |
| InChIKey | HMLVYNGGOOQKLY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|