C17H14BrClN2O2S — CID 1285572
(E)-3-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]-2-cyano-N-propan-2-ylprop-2-enamide (PubChem CID 1285572) has the molecular formula C17H14BrClN2O2S and a molecular weight of 425.74 g/mol. Its IUPAC name is (E)-3-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]-2-cyano-N-propan-2-ylprop-2-enamide.
| Compound Name | (E)-3-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]-2-cyano-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 1285572 |
| Molecular Formula | C17H14BrClN2O2S |
| Molecular Weight | 425.74 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | (E)-3-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]-2-cyano-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)NC(=O)/C(C#N)=C/c1cc(Br)c(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C17H14BrClN2O2S/c1-10(2)21-16(22)11(9-20)7-13-8-15(18)17(23-13)24-14-5-3-12(19)4-6-14/h3-8,10H,1-2H3,(H,21,22)/b11-7+ |
| InChIKey | SEKIWUCMEFSIAZ-YRNVUSSQSA-N |
| XLogP | 5.28 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.74 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|