C21H16N4O5S2 — CID 43840707
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide (PubChem CID 43840707) has the molecular formula C21H16N4O5S2 and a molecular weight of 468.52 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 43840707 |
| Molecular Formula | C21H16N4O5S2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(C(=O)Nc3nnc(SCc4ccccc4)s3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H16N4O5S2/c1-29-14-7-8-15(16(11-14)25(27)28)17-9-10-18(30-17)19(26)22-20-23-24-21(32-20)31-12-13-5-3-2-4-6-13/h2-11H,12H2,1H3,(H,22,23,26) |
| InChIKey | JEHCSMSLLGXFMQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|