C20H18N2O5 — CID 43840667
N-(2,3-dimethylphenyl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide (PubChem CID 43840667) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 43840667 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(2,3-dimethylphenyl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(C(=O)Nc3cccc(C)c3C)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18N2O5/c1-12-5-4-6-16(13(12)2)21-20(23)19-10-9-18(27-19)15-8-7-14(26-3)11-17(15)22(24)25/h4-11H,1-3H3,(H,21,23) |
| InChIKey | CWHJBJOWYGEDFM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|