C25H17N3O4 — CID 6196994
(E)-2-cyano-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-N-naphthalen-2-ylprop-2-enamide (PubChem CID 6196994) has the molecular formula C25H17N3O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-N-naphthalen-2-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-N-naphthalen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 6196994 |
| Molecular Formula | C25H17N3O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (E)-2-cyano-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-N-naphthalen-2-ylprop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C(\C#N)C(=O)Nc3ccc4ccccc4c3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H17N3O4/c1-16-6-10-22(23(12-16)28(30)31)24-11-9-21(32-24)14-19(15-26)25(29)27-20-8-7-17-4-2-3-5-18(17)13-20/h2-14H,1H3,(H,27,29)/b19-14+ |
| InChIKey | RYTZKKIBVHVGLI-XMHGGMMESA-N |
| XLogP | 5.86 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|