C22H19N5O5S2 — CID 171331974
2-cyano-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171331974) has the molecular formula C22H19N5O5S2 and a molecular weight of 497.56 g/mol. Its IUPAC name is 2-cyano-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171331974 |
| Molecular Formula | C22H19N5O5S2 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 2-cyano-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2nc(SC)ns2)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H19N5O5S2/c1-3-31-19-11-15(10-16(12-23)20(28)24-21-25-22(33-2)26-34-21)6-9-18(19)32-13-14-4-7-17(8-5-14)27(29)30/h4-11H,3,13H2,1-2H3,(H,24,25,26,28) |
| InChIKey | HUZJKVLRWDAUKJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|