C26H22BrN3O6 — CID 4301425
3-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2-cyano-N-(2-methoxy-4-nitrophenyl)prop-2-enamide (PubChem CID 4301425) has the molecular formula C26H22BrN3O6 and a molecular weight of 552.38 g/mol. Its IUPAC name is 3-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2-cyano-N-(2-methoxy-4-nitrophenyl)prop-2-enamide.
| Compound Name | 3-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2-cyano-N-(2-methoxy-4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4301425 |
| Molecular Formula | C26H22BrN3O6 |
| Molecular Weight | 552.38 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | 3-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2-cyano-N-(2-methoxy-4-nitrophenyl)prop-2-enamide |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2ccc([N+](=O)[O-])cc2OC)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C26H22BrN3O6/c1-3-35-25-13-18(6-11-23(25)36-16-17-4-7-20(27)8-5-17)12-19(15-28)26(31)29-22-10-9-21(30(32)33)14-24(22)34-2/h4-14H,3,16H2,1-2H3,(H,29,31) |
| InChIKey | AYLJWQUOUVZJER-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 123.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.38 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|