C26H26ClN3O4S — CID 170912704
(Z)-3-[3-chloro-4-[3-(2,5-dimethylphenoxy)propoxy]-5-ethoxyphenyl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 170912704) has the molecular formula C26H26ClN3O4S and a molecular weight of 512.03 g/mol. Its IUPAC name is (Z)-3-[3-chloro-4-[3-(2,5-dimethylphenoxy)propoxy]-5-ethoxyphenyl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-4-[3-(2,5-dimethylphenoxy)propoxy]-5-ethoxyphenyl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170912704 |
| Molecular Formula | C26H26ClN3O4S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (Z)-3-[3-chloro-4-[3-(2,5-dimethylphenoxy)propoxy]-5-ethoxyphenyl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2nccs2)cc(Cl)c1OCCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C26H26ClN3O4S/c1-4-32-23-15-19(13-20(16-28)25(31)30-26-29-8-11-35-26)14-21(27)24(23)34-10-5-9-33-22-12-17(2)6-7-18(22)3/h6-8,11-15H,4-5,9-10H2,1-3H3,(H,29,30,31)/b20-13- |
| InChIKey | FYJOFMAXQCJHBQ-MOSHPQCFSA-N |
| XLogP | 6.21 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|