C23H12Br2ClF3N2O4S — CID 126071782
[2,4-dibromo-6-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126071782) has the molecular formula C23H12Br2ClF3N2O4S and a molecular weight of 664.68 g/mol. Its IUPAC name is [2,4-dibromo-6-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2,4-dibromo-6-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126071782 |
| Molecular Formula | C23H12Br2ClF3N2O4S |
| Molecular Weight | 664.68 g/mol |
| Exact Mass | 661.85 |
| IUPAC Name | [2,4-dibromo-6-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | N#C/C(=C\c1cc(Br)cc(Br)c1OS(=O)(=O)c1ccc(Cl)cc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H12Br2ClF3N2O4S/c24-16-9-13(21(20(25)11-16)35-36(33,34)19-6-4-17(26)5-7-19)8-14(12-30)22(32)31-18-3-1-2-15(10-18)23(27,28)29/h1-11H,(H,31,32)/b14-8+ |
| InChIKey | RVUWANYMZSCMLF-RIYZIHGNSA-N |
| XLogP | 7.20 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.68 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|