C24H16ClF3N2O5S — CID 126070332
[4-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 126070332) has the molecular formula C24H16ClF3N2O5S and a molecular weight of 536.92 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126070332 |
| Molecular Formula | C24H16ClF3N2O5S |
| Molecular Weight | 536.92 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | [4-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2cccc(C(F)(F)F)c2)ccc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H16ClF3N2O5S/c1-34-22-12-15(5-10-21(22)35-36(32,33)20-8-6-18(25)7-9-20)11-16(14-29)23(31)30-19-4-2-3-17(13-19)24(26,27)28/h2-13H,1H3,(H,30,31)/b16-11+ |
| InChIKey | ASLASQJOLYGVLW-LFIBNONCSA-N |
| XLogP | 5.68 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.92 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|