C24H17Br2ClN2O3 — CID 126054463
(E)-2-cyano-3-[3,5-dibromo-2-[(2-chlorophenyl)methoxy]phenyl]-N-(4-methoxyphenyl)prop-2-enamide (PubChem CID 126054463) has the molecular formula C24H17Br2ClN2O3 and a molecular weight of 576.67 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dibromo-2-[(2-chlorophenyl)methoxy]phenyl]-N-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dibromo-2-[(2-chlorophenyl)methoxy]phenyl]-N-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126054463 |
| Molecular Formula | C24H17Br2ClN2O3 |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 573.93 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dibromo-2-[(2-chlorophenyl)methoxy]phenyl]-N-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C/c2cc(Br)cc(Br)c2OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H17Br2ClN2O3/c1-31-20-8-6-19(7-9-20)29-24(30)17(13-28)10-16-11-18(25)12-21(26)23(16)32-14-15-4-2-3-5-22(15)27/h2-12H,14H2,1H3,(H,29,30)/b17-10+ |
| InChIKey | QRHLHDRVMDZCQC-LICLKQGHSA-N |
| XLogP | 7.00 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|