C26H19F3IN3O5 — CID 126086013
(E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-iodo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide (PubChem CID 126086013) has the molecular formula C26H19F3IN3O5 and a molecular weight of 637.35 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-iodo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-iodo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126086013 |
| Molecular Formula | C26H19F3IN3O5 |
| Molecular Weight | 637.35 g/mol |
| Exact Mass | 637.03 |
| IUPAC Name | (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-iodo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2cccc(C)c2C)cc(I)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H19F3IN3O5/c1-14-5-4-6-20(15(14)2)32-25(34)17(13-31)9-16-10-19(30)24(23(11-16)37-3)38-22-8-7-18(26(27,28)29)12-21(22)33(35)36/h4-12H,1-3H3,(H,32,34)/b17-9+ |
| InChIKey | LNRYLVPDTPIQPB-RQZCQDPDSA-N |
| XLogP | 7.18 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.35 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|