C24H16F3N3O4 — CID 126098933
(E)-2-cyano-N-(2-methylphenyl)-3-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide (PubChem CID 126098933) has the molecular formula C24H16F3N3O4 and a molecular weight of 467.40 g/mol. Its IUPAC name is (E)-2-cyano-N-(2-methylphenyl)-3-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2-methylphenyl)-3-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126098933 |
| Molecular Formula | C24H16F3N3O4 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (E)-2-cyano-N-(2-methylphenyl)-3-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C/c1ccccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16F3N3O4/c1-15-6-2-4-8-19(15)29-23(31)17(14-28)12-16-7-3-5-9-21(16)34-22-11-10-18(24(25,26)27)13-20(22)30(32)33/h2-13H,1H3,(H,29,31)/b17-12+ |
| InChIKey | XCMHVNCWKNVXTE-SFQUDFHCSA-N |
| XLogP | 6.26 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|