C10H8BrClN4OS — CID 168628389
2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-bromo-4-chlorophenol (PubChem CID 168628389) has the molecular formula C10H8BrClN4OS and a molecular weight of 347.63 g/mol. Its IUPAC name is 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-bromo-4-chlorophenol.
| Compound Name | 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-bromo-4-chlorophenol |
|---|---|
| PubChem CID | 168628389 |
| Molecular Formula | C10H8BrClN4OS |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-bromo-4-chlorophenol |
| SMILES | Nc1csc(NN=Cc2cc(Cl)c(Br)cc2O)n1 |
| InChI | InChI=1S/C10H8BrClN4OS/c11-6-2-8(17)5(1-7(6)12)3-14-16-10-15-9(13)4-18-10/h1-4,17H,13H2,(H,15,16) |
| InChIKey | IRFSYOQJBCYYSB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|