C10H8BrIN4S — CID 168628267
2-N-[(2-bromo-6-iodophenyl)methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168628267) has the molecular formula C10H8BrIN4S and a molecular weight of 423.08 g/mol. Its IUPAC name is 2-N-[(2-bromo-6-iodophenyl)methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[(2-bromo-6-iodophenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168628267 |
| Molecular Formula | C10H8BrIN4S |
| Molecular Weight | 423.08 g/mol |
| Exact Mass | 421.87 |
| IUPAC Name | 2-N-[(2-bromo-6-iodophenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2c(Br)cccc2I)n1 |
| InChI | InChI=1S/C10H8BrIN4S/c11-7-2-1-3-8(12)6(7)4-14-16-10-15-9(13)5-17-10/h1-5H,13H2,(H,15,16) |
| InChIKey | KFPFZAANPPZRSK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.08 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|