About 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol
2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol (PubChem CID 168628387) has the molecular formula C16H15N5O2S
and a molecular weight of 341.40 g/mol. Its IUPAC name is 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol.
Molecular Properties
| Compound Name | 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol |
| PubChem CID | 168628387 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol |
| SMILES | COc1ccc(-c2ccc(O)c(C=NNc3nc(N)cs3)c2)cn1 |
| InChI | InChI=1S/C16H15N5O2S/c1-23-15-5-3-11(7-18-15)10-2-4-13(22)12(6-10)8-19-21-16-20-14(17)9-24-16/h2-9,22H,17H2,1H3,(H,20,21) |
| InChIKey | BGTVYZUHVSLPQN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol?
The IUPAC name of 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol (CID 168628387) is 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol.
What is the SMILES notation for 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol?
The canonical SMILES for 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol is COc1ccc(-c2ccc(O)c(C=NNc3nc(N)cs3)c2)cn1.
What is the InChIKey of 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol?
The InChIKey is BGTVYZUHVSLPQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O2S/c1-23-15-5-3-11(7-18-15)10-2-4-13(22)12(6-10)8-19-21-16-20-14(17)9-24-16/h2-9,22H,17H2,1H3,(H,20,21).
What are the key properties of 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol?
2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol has a molecular weight of 341.40 g/mol, XLogP of 2.95, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(6-methoxy-3-pyridinyl)phenol is sourced from PubChem (CID 168628387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).