C17H18ClN3O4 — CID 110505749
6-[(2E)-2-[(3-chloro-4,5-diethoxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid (PubChem CID 110505749) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is 6-[(2E)-2-[(3-chloro-4,5-diethoxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[(2E)-2-[(3-chloro-4,5-diethoxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 110505749 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 6-[(2E)-2-[(3-chloro-4,5-diethoxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid |
| SMILES | CCOc1cc(/C=N/Nc2ccc(C(=O)O)cn2)cc(Cl)c1OCC |
| InChI | InChI=1S/C17H18ClN3O4/c1-3-24-14-8-11(7-13(18)16(14)25-4-2)9-20-21-15-6-5-12(10-19-15)17(22)23/h5-10H,3-4H2,1-2H3,(H,19,21)(H,22,23)/b20-9+ |
| InChIKey | ATFBUVWCIWALFN-AWQFTUOYSA-N |
| XLogP | 3.68 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|