C24H23N3O5 — CID 169383486
methyl 2-[[2-[2-methoxy-4-[(phenylhydrazinylidene)methyl]phenoxy]acetyl]amino]benzoate (PubChem CID 169383486) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is methyl 2-[[2-[2-methoxy-4-[(phenylhydrazinylidene)methyl]phenoxy]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[2-methoxy-4-[(phenylhydrazinylidene)methyl]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 169383486 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | methyl 2-[[2-[2-methoxy-4-[(phenylhydrazinylidene)methyl]phenoxy]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COc1ccc(C=NNc2ccccc2)cc1OC |
| InChI | InChI=1S/C24H23N3O5/c1-30-22-14-17(15-25-27-18-8-4-3-5-9-18)12-13-21(22)32-16-23(28)26-20-11-7-6-10-19(20)24(29)31-2/h3-15,27H,16H2,1-2H3,(H,26,28) |
| InChIKey | PCVXLXNXCAJJIB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|