C23H15BrN6O2 — CID 6410889
[4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenyl] 4-bromobenzoate (PubChem CID 6410889) has the molecular formula C23H15BrN6O2 and a molecular weight of 487.32 g/mol. Its IUPAC name is [4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 6410889 |
| Molecular Formula | C23H15BrN6O2 |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | [4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenyl] 4-bromobenzoate |
| SMILES | O=C(Oc1ccc(/C=N\Nc2nnc3c(n2)[nH]c2ccccc23)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H15BrN6O2/c24-16-9-7-15(8-10-16)22(31)32-17-11-5-14(6-12-17)13-25-29-23-27-21-20(28-30-23)18-3-1-2-4-19(18)26-21/h1-13H,(H2,26,27,29,30)/b25-13- |
| InChIKey | CEJYQLXGCXZUKP-MXAYSNPKSA-N |
| XLogP | 4.93 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|