C15H10N4O5S — CID 23351999
2-methyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-one (PubChem CID 23351999) has the molecular formula C15H10N4O5S and a molecular weight of 358.34 g/mol. Its IUPAC name is 2-methyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-methyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23351999 |
| Molecular Formula | C15H10N4O5S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-methyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2sccc2c(=O)n1N=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C15H10N4O5S/c1-8-17-14-10(2-3-25-14)15(20)18(8)16-6-9-4-12-13(24-7-23-12)5-11(9)19(21)22/h2-6H,7H2,1H3 |
| InChIKey | YQHNDKIBIRWDTI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|