C16H11N5OS — CID 9296302
2-methyl-3-[(Z)-quinoxalin-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-one (PubChem CID 9296302) has the molecular formula C16H11N5OS and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-methyl-3-[(Z)-quinoxalin-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-methyl-3-[(Z)-quinoxalin-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 9296302 |
| Molecular Formula | C16H11N5OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-methyl-3-[(Z)-quinoxalin-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2sccc2c(=O)n1/N=C\c1cnc2ccccc2n1 |
| InChI | InChI=1S/C16H11N5OS/c1-10-19-15-12(6-7-23-15)16(22)21(10)18-9-11-8-17-13-4-2-3-5-14(13)20-11/h2-9H,1H3/b18-9- |
| InChIKey | HUKOVAKYVJIIKM-NVMNQCDNSA-N |
| XLogP | 2.59 |
| TPSA | 73.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|