C20H23N3O3S — CID 23352028
3-[(4-butoxy-3-ethoxyphenyl)methylideneamino]-2-methylthieno[2,3-d]pyrimidin-4-one (PubChem CID 23352028) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-[(4-butoxy-3-ethoxyphenyl)methylideneamino]-2-methylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(4-butoxy-3-ethoxyphenyl)methylideneamino]-2-methylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23352028 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 3-[(4-butoxy-3-ethoxyphenyl)methylideneamino]-2-methylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCCOc1ccc(C=Nn2c(C)nc3sccc3c2=O)cc1OCC |
| InChI | InChI=1S/C20H23N3O3S/c1-4-6-10-26-17-8-7-15(12-18(17)25-5-2)13-21-23-14(3)22-19-16(20(23)24)9-11-27-19/h7-9,11-13H,4-6,10H2,1-3H3 |
| InChIKey | GMCBADRDKLBUKE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|