C15H12N4O5S — CID 135729442
3-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-methylthieno[2,3-d]pyrimidin-4-one (PubChem CID 135729442) has the molecular formula C15H12N4O5S and a molecular weight of 360.35 g/mol. Its IUPAC name is 3-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-methylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-methylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135729442 |
| Molecular Formula | C15H12N4O5S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 3-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-methylthieno[2,3-d]pyrimidin-4-one |
| SMILES | COc1cc(C=Nn2c(C)nc3sccc3c2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C15H12N4O5S/c1-8-17-14-10(3-4-25-14)15(21)18(8)16-7-9-5-11(19(22)23)13(20)12(6-9)24-2/h3-7,20H,1-2H3 |
| InChIKey | WSVBVOCEJIOKSK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|